C17H28FNO2 — CID 171974279
tert-butyl 3-(4-fluorobutyl)-9-azabicyclo[3.3.1]non-2-ene-9-carboxylate (PubChem CID 171974279) has the molecular formula C17H28FNO2 and a molecular weight of 297.41 g/mol. Its IUPAC name is tert-butyl 3-(4-fluorobutyl)-9-azabicyclo[3.3.1]non-2-ene-9-carboxylate.
| Compound Name | tert-butyl 3-(4-fluorobutyl)-9-azabicyclo[3.3.1]non-2-ene-9-carboxylate |
|---|---|
| PubChem CID | 171974279 |
| Molecular Formula | C17H28FNO2 |
| Molecular Weight | 297.41 g/mol |
| Exact Mass | 297.21 |
| IUPAC Name | tert-butyl 3-(4-fluorobutyl)-9-azabicyclo[3.3.1]non-2-ene-9-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C2C=C(CCCCF)CC1CCC2 |
| InChI | InChI=1S/C17H28FNO2/c1-17(2,3)21-16(20)19-14-8-6-9-15(19)12-13(11-14)7-4-5-10-18/h11,14-15H,4-10,12H2,1-3H3 |
| InChIKey | SRXRMUNFEXDDLI-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.41 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|