About 3-dodecyl-8λ4-thiabicyclo[3.2.1]oct-2-ene 8-oxide
3-dodecyl-8λ4-thiabicyclo[3.2.1]oct-2-ene 8-oxide (PubChem CID 171974309) has the molecular formula C19H34OS
and a molecular weight of 310.55 g/mol. Its IUPAC name is 3-dodecyl-8λ4-thiabicyclo[3.2.1]oct-2-ene 8-oxide.
Molecular Properties
| Compound Name | 3-dodecyl-8λ4-thiabicyclo[3.2.1]oct-2-ene 8-oxide |
| PubChem CID | 171974309 |
| Molecular Formula | C19H34OS |
| Molecular Weight | 310.55 g/mol |
| Exact Mass | 310.23 |
| IUPAC Name | 3-dodecyl-8λ4-thiabicyclo[3.2.1]oct-2-ene 8-oxide |
| SMILES | CCCCCCCCCCCCC1=CC2CCC(C1)S2=O |
| InChI | InChI=1S/C19H34OS/c1-2-3-4-5-6-7-8-9-10-11-12-17-15-18-13-14-19(16-17)21(18)20/h15,18-19H,2-14,16H2,1H3 |
| InChIKey | JWTKRVNYFWSMLK-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 310.55 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-dodecyl-8λ4-thiabicyclo[3.2.1]oct-2-ene 8-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-dodecyl-8λ4-thiabicyclo[3.2.1]oct-2-ene 8-oxide?
The IUPAC name of 3-dodecyl-8λ4-thiabicyclo[3.2.1]oct-2-ene 8-oxide (CID 171974309) is 3-dodecyl-8λ4-thiabicyclo[3.2.1]oct-2-ene 8-oxide.
What is the SMILES notation for 3-dodecyl-8λ4-thiabicyclo[3.2.1]oct-2-ene 8-oxide?
The canonical SMILES for 3-dodecyl-8λ4-thiabicyclo[3.2.1]oct-2-ene 8-oxide is CCCCCCCCCCCCC1=CC2CCC(C1)S2=O.
What is the InChIKey of 3-dodecyl-8λ4-thiabicyclo[3.2.1]oct-2-ene 8-oxide?
The InChIKey is JWTKRVNYFWSMLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H34OS/c1-2-3-4-5-6-7-8-9-10-11-12-17-15-18-13-14-19(16-17)21(18)20/h15,18-19H,2-14,16H2,1H3.
What are the key properties of 3-dodecyl-8λ4-thiabicyclo[3.2.1]oct-2-ene 8-oxide?
3-dodecyl-8λ4-thiabicyclo[3.2.1]oct-2-ene 8-oxide has a molecular weight of 310.55 g/mol, XLogP of 5.91, 11 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-dodecyl-8λ4-thiabicyclo[3.2.1]oct-2-ene 8-oxide is sourced from PubChem (CID 171974309), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).