C18H19NO2 — CID 171974416
9-benzyl-7-(furan-3-yl)-3-oxa-9-azabicyclo[3.3.1]non-6-ene (PubChem CID 171974416) has the molecular formula C18H19NO2 and a molecular weight of 281.36 g/mol. Its IUPAC name is 9-benzyl-7-(furan-3-yl)-3-oxa-9-azabicyclo[3.3.1]non-6-ene.
| Compound Name | 9-benzyl-7-(furan-3-yl)-3-oxa-9-azabicyclo[3.3.1]non-6-ene |
|---|---|
| PubChem CID | 171974416 |
| Molecular Formula | C18H19NO2 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | 9-benzyl-7-(furan-3-yl)-3-oxa-9-azabicyclo[3.3.1]non-6-ene |
| SMILES | C1=C(c2ccoc2)CC2COCC1N2Cc1ccccc1 |
| InChI | InChI=1S/C18H19NO2/c1-2-4-14(5-3-1)10-19-17-8-16(15-6-7-20-11-15)9-18(19)13-21-12-17/h1-8,11,17-18H,9-10,12-13H2 |
| InChIKey | AKMSVLULAIGVSA-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 25.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |