C20H23N — CID 171974433
9-methyl-3-(naphthalen-1-ylmethyl)-9-azabicyclo[3.3.1]non-2-ene (PubChem CID 171974433) has the molecular formula C20H23N and a molecular weight of 277.41 g/mol. Its IUPAC name is 9-methyl-3-(naphthalen-1-ylmethyl)-9-azabicyclo[3.3.1]non-2-ene.
| Compound Name | 9-methyl-3-(naphthalen-1-ylmethyl)-9-azabicyclo[3.3.1]non-2-ene |
|---|---|
| PubChem CID | 171974433 |
| Molecular Formula | C20H23N |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | 9-methyl-3-(naphthalen-1-ylmethyl)-9-azabicyclo[3.3.1]non-2-ene |
| SMILES | CN1C2C=C(Cc3cccc4ccccc34)CC1CCC2 |
| InChI | InChI=1S/C20H23N/c1-21-18-9-5-10-19(21)14-15(13-18)12-17-8-4-7-16-6-2-3-11-20(16)17/h2-4,6-8,11,13,18-19H,5,9-10,12,14H2,1H3 |
| InChIKey | KQSIVWMDQYVRKT-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|