C15H14N2O2S — CID 171974711
3-quinoxalin-6-yl-8λ6-thiabicyclo[3.2.1]oct-2-ene 8,8-dioxide (PubChem CID 171974711) has the molecular formula C15H14N2O2S and a molecular weight of 286.36 g/mol. Its IUPAC name is 3-quinoxalin-6-yl-8λ6-thiabicyclo[3.2.1]oct-2-ene 8,8-dioxide.
| Compound Name | 3-quinoxalin-6-yl-8λ6-thiabicyclo[3.2.1]oct-2-ene 8,8-dioxide |
|---|---|
| PubChem CID | 171974711 |
| Molecular Formula | C15H14N2O2S |
| Molecular Weight | 286.36 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | 3-quinoxalin-6-yl-8λ6-thiabicyclo[3.2.1]oct-2-ene 8,8-dioxide |
| SMILES | O=S1(=O)C2C=C(c3ccc4nccnc4c3)CC1CC2 |
| InChI | InChI=1S/C15H14N2O2S/c18-20(19)12-2-3-13(20)8-11(7-12)10-1-4-14-15(9-10)17-6-5-16-14/h1,4-7,9,12-13H,2-3,8H2 |
| InChIKey | SHMLTHLDZUXXGM-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.36 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |