About 2-methoxy-6-(9-oxo-9λ4-thiabicyclo[3.3.1]non-2-en-3-yl)benzonitrile
2-methoxy-6-(9-oxo-9λ4-thiabicyclo[3.3.1]non-2-en-3-yl)benzonitrile (PubChem CID 171975131) has the molecular formula C16H17NO2S
and a molecular weight of 287.38 g/mol. Its IUPAC name is 2-methoxy-6-(9-oxo-9λ4-thiabicyclo[3.3.1]non-2-en-3-yl)benzonitrile.
Molecular Properties
| Compound Name | 2-methoxy-6-(9-oxo-9λ4-thiabicyclo[3.3.1]non-2-en-3-yl)benzonitrile |
| PubChem CID | 171975131 |
| Molecular Formula | C16H17NO2S |
| Molecular Weight | 287.38 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | 2-methoxy-6-(9-oxo-9λ4-thiabicyclo[3.3.1]non-2-en-3-yl)benzonitrile |
| SMILES | COc1cccc(C2=CC3CCCC(C2)S3=O)c1C#N |
| InChI | InChI=1S/C16H17NO2S/c1-19-16-7-3-6-14(15(16)10-17)11-8-12-4-2-5-13(9-11)20(12)18/h3,6-8,12-13H,2,4-5,9H2,1H3 |
| InChIKey | JNTDVNZXGYCOJK-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.38 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methoxy-6-(9-oxo-9λ4-thiabicyclo[3.3.1]non-2-en-3-yl)benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxy-6-(9-oxo-9λ4-thiabicyclo[3.3.1]non-2-en-3-yl)benzonitrile?
The IUPAC name of 2-methoxy-6-(9-oxo-9λ4-thiabicyclo[3.3.1]non-2-en-3-yl)benzonitrile (CID 171975131) is 2-methoxy-6-(9-oxo-9λ4-thiabicyclo[3.3.1]non-2-en-3-yl)benzonitrile.
What is the SMILES notation for 2-methoxy-6-(9-oxo-9λ4-thiabicyclo[3.3.1]non-2-en-3-yl)benzonitrile?
The canonical SMILES for 2-methoxy-6-(9-oxo-9λ4-thiabicyclo[3.3.1]non-2-en-3-yl)benzonitrile is COc1cccc(C2=CC3CCCC(C2)S3=O)c1C#N.
What is the InChIKey of 2-methoxy-6-(9-oxo-9λ4-thiabicyclo[3.3.1]non-2-en-3-yl)benzonitrile?
The InChIKey is JNTDVNZXGYCOJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17NO2S/c1-19-16-7-3-6-14(15(16)10-17)11-8-12-4-2-5-13(9-11)20(12)18/h3,6-8,12-13H,2,4-5,9H2,1H3.
What are the key properties of 2-methoxy-6-(9-oxo-9λ4-thiabicyclo[3.3.1]non-2-en-3-yl)benzonitrile?
2-methoxy-6-(9-oxo-9λ4-thiabicyclo[3.3.1]non-2-en-3-yl)benzonitrile has a molecular weight of 287.38 g/mol, XLogP of 3.02, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxy-6-(9-oxo-9λ4-thiabicyclo[3.3.1]non-2-en-3-yl)benzonitrile is sourced from PubChem (CID 171975131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).