C10H16N2O3 — CID 171975348
(2S,3S)-4-(5,6-dimethylpyrazin-2-yl)butane-1,2,3-triol (PubChem CID 171975348) has the molecular formula C10H16N2O3 and a molecular weight of 212.25 g/mol. Its IUPAC name is (2S,3S)-4-(5,6-dimethylpyrazin-2-yl)butane-1,2,3-triol.
| Compound Name | (2S,3S)-4-(5,6-dimethylpyrazin-2-yl)butane-1,2,3-triol |
|---|---|
| PubChem CID | 171975348 |
| Molecular Formula | C10H16N2O3 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.12 |
| IUPAC Name | (2S,3S)-4-(5,6-dimethylpyrazin-2-yl)butane-1,2,3-triol |
| SMILES | Cc1ncc(C[C@H](O)[C@@H](O)CO)nc1C |
| InChI | InChI=1S/C10H16N2O3/c1-6-7(2)12-8(4-11-6)3-9(14)10(15)5-13/h4,9-10,13-15H,3,5H2,1-2H3/t9-,10-/m0/s1 |
| InChIKey | VGDHNFVGKBXHQC-UWVGGRQHSA-N |
| XLogP | -0.65 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |