About tert-butyl (2S,3S)-2-(2-methylpropyl)-5-oxo-3-prop-1-en-2-ylpyrrolidine-1-carboxylate
tert-butyl (2S,3S)-2-(2-methylpropyl)-5-oxo-3-prop-1-en-2-ylpyrrolidine-1-carboxylate (PubChem CID 171975369) has the molecular formula C16H27NO3
and a molecular weight of 281.40 g/mol. Its IUPAC name is tert-butyl (2S,3S)-2-(2-methylpropyl)-5-oxo-3-prop-1-en-2-ylpyrrolidine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl (2S,3S)-2-(2-methylpropyl)-5-oxo-3-prop-1-en-2-ylpyrrolidine-1-carboxylate |
| PubChem CID | 171975369 |
| Molecular Formula | C16H27NO3 |
| Molecular Weight | 281.40 g/mol |
| Exact Mass | 281.20 |
| IUPAC Name | tert-butyl (2S,3S)-2-(2-methylpropyl)-5-oxo-3-prop-1-en-2-ylpyrrolidine-1-carboxylate |
| SMILES | C=C(C)[C@@H]1CC(=O)N(C(=O)OC(C)(C)C)[C@H]1CC(C)C |
| InChI | InChI=1S/C16H27NO3/c1-10(2)8-13-12(11(3)4)9-14(18)17(13)15(19)20-16(5,6)7/h10,12-13H,3,8-9H2,1-2,4-7H3/t12-,13-/m0/s1 |
| InChIKey | JHZMLDDOCYYFHH-STQMWFEESA-N |
| XLogP | 3.76 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.40 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl (2S,3S)-2-(2-methylpropyl)-5-oxo-3-prop-1-en-2-ylpyrrolidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (2S,3S)-2-(2-methylpropyl)-5-oxo-3-prop-1-en-2-ylpyrrolidine-1-carboxylate?
The IUPAC name of tert-butyl (2S,3S)-2-(2-methylpropyl)-5-oxo-3-prop-1-en-2-ylpyrrolidine-1-carboxylate (CID 171975369) is tert-butyl (2S,3S)-2-(2-methylpropyl)-5-oxo-3-prop-1-en-2-ylpyrrolidine-1-carboxylate.
What is the SMILES notation for tert-butyl (2S,3S)-2-(2-methylpropyl)-5-oxo-3-prop-1-en-2-ylpyrrolidine-1-carboxylate?
The canonical SMILES for tert-butyl (2S,3S)-2-(2-methylpropyl)-5-oxo-3-prop-1-en-2-ylpyrrolidine-1-carboxylate is C=C(C)[C@@H]1CC(=O)N(C(=O)OC(C)(C)C)[C@H]1CC(C)C.
What is the InChIKey of tert-butyl (2S,3S)-2-(2-methylpropyl)-5-oxo-3-prop-1-en-2-ylpyrrolidine-1-carboxylate?
The InChIKey is JHZMLDDOCYYFHH-STQMWFEESA-N. The full InChI is InChI=1S/C16H27NO3/c1-10(2)8-13-12(11(3)4)9-14(18)17(13)15(19)20-16(5,6)7/h10,12-13H,3,8-9H2,1-2,4-7H3/t12-,13-/m0/s1.
What are the key properties of tert-butyl (2S,3S)-2-(2-methylpropyl)-5-oxo-3-prop-1-en-2-ylpyrrolidine-1-carboxylate?
tert-butyl (2S,3S)-2-(2-methylpropyl)-5-oxo-3-prop-1-en-2-ylpyrrolidine-1-carboxylate has a molecular weight of 281.40 g/mol, XLogP of 3.76, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (2S,3S)-2-(2-methylpropyl)-5-oxo-3-prop-1-en-2-ylpyrrolidine-1-carboxylate is sourced from PubChem (CID 171975369), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).