C8H12O4 — CID 171975699
methyl (2R,3S)-4-oxo-3-propan-2-yloxetane-2-carboxylate (PubChem CID 171975699) has the molecular formula C8H12O4 and a molecular weight of 172.18 g/mol. Its IUPAC name is methyl (2R,3S)-4-oxo-3-propan-2-yloxetane-2-carboxylate.
| Compound Name | methyl (2R,3S)-4-oxo-3-propan-2-yloxetane-2-carboxylate |
|---|---|
| PubChem CID | 171975699 |
| Molecular Formula | C8H12O4 |
| Molecular Weight | 172.18 g/mol |
| Exact Mass | 172.07 |
| IUPAC Name | methyl (2R,3S)-4-oxo-3-propan-2-yloxetane-2-carboxylate |
| SMILES | COC(=O)[C@@H]1OC(=O)[C@H]1C(C)C |
| InChI | InChI=1S/C8H12O4/c1-4(2)5-6(8(10)11-3)12-7(5)9/h4-6H,1-3H3/t5-,6+/m0/s1 |
| InChIKey | HKLQVNQDYREDFD-NTSWFWBYSA-N |
| XLogP | 0.36 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.18 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'four_member_lactones', 'substructure': 'N/A'} |
|---|