About but-3-ynyl pyrimidine-2-carboxylate
but-3-ynyl pyrimidine-2-carboxylate (PubChem CID 171976037) has the molecular formula C9H8N2O2
and a molecular weight of 176.18 g/mol. Its IUPAC name is but-3-ynyl pyrimidine-2-carboxylate.
Molecular Properties
| Compound Name | but-3-ynyl pyrimidine-2-carboxylate |
| PubChem CID | 171976037 |
| Molecular Formula | C9H8N2O2 |
| Molecular Weight | 176.18 g/mol |
| Exact Mass | 176.06 |
| IUPAC Name | but-3-ynyl pyrimidine-2-carboxylate |
| SMILES | C#CCCOC(=O)c1ncccn1 |
| InChI | InChI=1S/C9H8N2O2/c1-2-3-7-13-9(12)8-10-5-4-6-11-8/h1,4-6H,3,7H2 |
| InChIKey | LRZLMRNKUSMSFD-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.18 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze but-3-ynyl pyrimidine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-3-ynyl pyrimidine-2-carboxylate?
The IUPAC name of but-3-ynyl pyrimidine-2-carboxylate (CID 171976037) is but-3-ynyl pyrimidine-2-carboxylate.
What is the SMILES notation for but-3-ynyl pyrimidine-2-carboxylate?
The canonical SMILES for but-3-ynyl pyrimidine-2-carboxylate is C#CCCOC(=O)c1ncccn1.
What is the InChIKey of but-3-ynyl pyrimidine-2-carboxylate?
The InChIKey is LRZLMRNKUSMSFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2O2/c1-2-3-7-13-9(12)8-10-5-4-6-11-8/h1,4-6H,3,7H2.
What are the key properties of but-3-ynyl pyrimidine-2-carboxylate?
but-3-ynyl pyrimidine-2-carboxylate has a molecular weight of 176.18 g/mol, XLogP of 0.66, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for but-3-ynyl pyrimidine-2-carboxylate is sourced from PubChem (CID 171976037), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).