C27H27NO5 — CID 171976226
dimethyl 4-cyclohexyl-2-oxo-7-phenyl-4-azatricyclo[6.4.0.03,5]dodeca-1(12),6,8,10-tetraene-5,6-dicarboxylate (PubChem CID 171976226) has the molecular formula C27H27NO5 and a molecular weight of 445.52 g/mol. Its IUPAC name is dimethyl 4-cyclohexyl-2-oxo-7-phenyl-4-azatricyclo[6.4.0.03,5]dodeca-1(12),6,8,10-tetraene-5,6-dicarboxylate.
| Compound Name | dimethyl 4-cyclohexyl-2-oxo-7-phenyl-4-azatricyclo[6.4.0.03,5]dodeca-1(12),6,8,10-tetraene-5,6-dicarboxylate |
|---|---|
| PubChem CID | 171976226 |
| Molecular Formula | C27H27NO5 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.19 |
| IUPAC Name | dimethyl 4-cyclohexyl-2-oxo-7-phenyl-4-azatricyclo[6.4.0.03,5]dodeca-1(12),6,8,10-tetraene-5,6-dicarboxylate |
| SMILES | COC(=O)C1=C(c2ccccc2)c2ccccc2C(=O)C2N(C3CCCCC3)C12C(=O)OC |
| InChI | InChI=1S/C27H27NO5/c1-32-25(30)22-21(17-11-5-3-6-12-17)19-15-9-10-16-20(19)23(29)24-27(22,26(31)33-2)28(24)18-13-7-4-8-14-18/h3,5-6,9-12,15-16,18,24H,4,7-8,13-14H2,1-2H3 |
| InChIKey | DBSWWWOYFGSRDG-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|