About 1-(6-amino-3-methyl-4-phenyl-2,4-dihydropyrano[2,3-c]pyrazol-5-yl)ethanone
1-(6-amino-3-methyl-4-phenyl-2,4-dihydropyrano[2,3-c]pyrazol-5-yl)ethanone (PubChem CID 171976478) has the molecular formula C15H15N3O2
and a molecular weight of 269.30 g/mol. Its IUPAC name is 1-(6-amino-3-methyl-4-phenyl-2,4-dihydropyrano[2,3-c]pyrazol-5-yl)ethanone.
Molecular Properties
| Compound Name | 1-(6-amino-3-methyl-4-phenyl-2,4-dihydropyrano[2,3-c]pyrazol-5-yl)ethanone |
| PubChem CID | 171976478 |
| Molecular Formula | C15H15N3O2 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | 1-(6-amino-3-methyl-4-phenyl-2,4-dihydropyrano[2,3-c]pyrazol-5-yl)ethanone |
| SMILES | CC(=O)C1=C(N)Oc2n[nH]c(C)c2C1c1ccccc1 |
| InChI | InChI=1S/C15H15N3O2/c1-8-11-13(10-6-4-3-5-7-10)12(9(2)19)14(16)20-15(11)18-17-8/h3-7,13H,16H2,1-2H3,(H,17,18) |
| InChIKey | TZRNPCOVBBTCTL-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(6-amino-3-methyl-4-phenyl-2,4-dihydropyrano[2,3-c]pyrazol-5-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(6-amino-3-methyl-4-phenyl-2,4-dihydropyrano[2,3-c]pyrazol-5-yl)ethanone?
The IUPAC name of 1-(6-amino-3-methyl-4-phenyl-2,4-dihydropyrano[2,3-c]pyrazol-5-yl)ethanone (CID 171976478) is 1-(6-amino-3-methyl-4-phenyl-2,4-dihydropyrano[2,3-c]pyrazol-5-yl)ethanone.
What is the SMILES notation for 1-(6-amino-3-methyl-4-phenyl-2,4-dihydropyrano[2,3-c]pyrazol-5-yl)ethanone?
The canonical SMILES for 1-(6-amino-3-methyl-4-phenyl-2,4-dihydropyrano[2,3-c]pyrazol-5-yl)ethanone is CC(=O)C1=C(N)Oc2n[nH]c(C)c2C1c1ccccc1.
What is the InChIKey of 1-(6-amino-3-methyl-4-phenyl-2,4-dihydropyrano[2,3-c]pyrazol-5-yl)ethanone?
The InChIKey is TZRNPCOVBBTCTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H15N3O2/c1-8-11-13(10-6-4-3-5-7-10)12(9(2)19)14(16)20-15(11)18-17-8/h3-7,13H,16H2,1-2H3,(H,17,18).
What are the key properties of 1-(6-amino-3-methyl-4-phenyl-2,4-dihydropyrano[2,3-c]pyrazol-5-yl)ethanone?
1-(6-amino-3-methyl-4-phenyl-2,4-dihydropyrano[2,3-c]pyrazol-5-yl)ethanone has a molecular weight of 269.30 g/mol, XLogP of 2.00, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(6-amino-3-methyl-4-phenyl-2,4-dihydropyrano[2,3-c]pyrazol-5-yl)ethanone is sourced from PubChem (CID 171976478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).