About 4-[(2E)-2-[(5-chloroimidazo[2,1-b][1,3]thiazol-6-yl)methylidene]hydrazinyl]benzoic acid
4-[(2E)-2-[(5-chloroimidazo[2,1-b][1,3]thiazol-6-yl)methylidene]hydrazinyl]benzoic acid (PubChem CID 171976924) has the molecular formula C13H9ClN4O2S
and a molecular weight of 320.76 g/mol. Its IUPAC name is 4-[(2E)-2-[(5-chloroimidazo[2,1-b][1,3]thiazol-6-yl)methylidene]hydrazinyl]benzoic acid.
Molecular Properties
| Compound Name | 4-[(2E)-2-[(5-chloroimidazo[2,1-b][1,3]thiazol-6-yl)methylidene]hydrazinyl]benzoic acid |
| PubChem CID | 171976924 |
| Molecular Formula | C13H9ClN4O2S |
| Molecular Weight | 320.76 g/mol |
| Exact Mass | 320.01 |
| IUPAC Name | 4-[(2E)-2-[(5-chloroimidazo[2,1-b][1,3]thiazol-6-yl)methylidene]hydrazinyl]benzoic acid |
| SMILES | O=C(O)c1ccc(N/N=C/c2nc3sccn3c2Cl)cc1 |
| InChI | InChI=1S/C13H9ClN4O2S/c14-11-10(16-13-18(11)5-6-21-13)7-15-17-9-3-1-8(2-4-9)12(19)20/h1-7,17H,(H,19,20)/b15-7+ |
| InChIKey | ODHKVTJFKACQSX-VIZOYTHASA-N |
| XLogP | 3.19 |
| TPSA | 78.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.76 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[(2E)-2-[(5-chloroimidazo[2,1-b][1,3]thiazol-6-yl)methylidene]hydrazinyl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2E)-2-[(5-chloroimidazo[2,1-b][1,3]thiazol-6-yl)methylidene]hydrazinyl]benzoic acid?
The IUPAC name of 4-[(2E)-2-[(5-chloroimidazo[2,1-b][1,3]thiazol-6-yl)methylidene]hydrazinyl]benzoic acid (CID 171976924) is 4-[(2E)-2-[(5-chloroimidazo[2,1-b][1,3]thiazol-6-yl)methylidene]hydrazinyl]benzoic acid.
What is the SMILES notation for 4-[(2E)-2-[(5-chloroimidazo[2,1-b][1,3]thiazol-6-yl)methylidene]hydrazinyl]benzoic acid?
The canonical SMILES for 4-[(2E)-2-[(5-chloroimidazo[2,1-b][1,3]thiazol-6-yl)methylidene]hydrazinyl]benzoic acid is O=C(O)c1ccc(N/N=C/c2nc3sccn3c2Cl)cc1.
What is the InChIKey of 4-[(2E)-2-[(5-chloroimidazo[2,1-b][1,3]thiazol-6-yl)methylidene]hydrazinyl]benzoic acid?
The InChIKey is ODHKVTJFKACQSX-VIZOYTHASA-N. The full InChI is InChI=1S/C13H9ClN4O2S/c14-11-10(16-13-18(11)5-6-21-13)7-15-17-9-3-1-8(2-4-9)12(19)20/h1-7,17H,(H,19,20)/b15-7+.
What are the key properties of 4-[(2E)-2-[(5-chloroimidazo[2,1-b][1,3]thiazol-6-yl)methylidene]hydrazinyl]benzoic acid?
4-[(2E)-2-[(5-chloroimidazo[2,1-b][1,3]thiazol-6-yl)methylidene]hydrazinyl]benzoic acid has a molecular weight of 320.76 g/mol, XLogP of 3.19, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2E)-2-[(5-chloroimidazo[2,1-b][1,3]thiazol-6-yl)methylidene]hydrazinyl]benzoic acid is sourced from PubChem (CID 171976924), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).