C20H18N2O4S — CID 171977128
4-[(2-methylsulfanylphenyl)iminomethyl]-2-nitro-6,7,8,9-tetrahydrodibenzofuran-3-ol (PubChem CID 171977128) has the molecular formula C20H18N2O4S and a molecular weight of 382.44 g/mol. Its IUPAC name is 4-[(2-methylsulfanylphenyl)iminomethyl]-2-nitro-6,7,8,9-tetrahydrodibenzofuran-3-ol.
| Compound Name | 4-[(2-methylsulfanylphenyl)iminomethyl]-2-nitro-6,7,8,9-tetrahydrodibenzofuran-3-ol |
|---|---|
| PubChem CID | 171977128 |
| Molecular Formula | C20H18N2O4S |
| Molecular Weight | 382.44 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | 4-[(2-methylsulfanylphenyl)iminomethyl]-2-nitro-6,7,8,9-tetrahydrodibenzofuran-3-ol |
| SMILES | CSc1ccccc1/N=C/c1c(O)c([N+](=O)[O-])cc2c3c(oc12)CCCC3 |
| InChI | InChI=1S/C20H18N2O4S/c1-27-18-9-5-3-7-15(18)21-11-14-19(23)16(22(24)25)10-13-12-6-2-4-8-17(12)26-20(13)14/h3,5,7,9-11,23H,2,4,6,8H2,1H3/b21-11+ |
| InChIKey | HJKRTLSGSITGQN-SRZZPIQSSA-N |
| XLogP | 5.40 |
| TPSA | 88.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.44 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|