C21H23N3O4S2 — CID 171977237
[4-[(Z)-[(Z)-(5,5-dimethyl-4-oxo-1,3-thiazolidin-2-ylidene)hydrazinylidene]methyl]phenyl] 4-propan-2-ylbenzenesulfonate (PubChem CID 171977237) has the molecular formula C21H23N3O4S2 and a molecular weight of 445.57 g/mol. Its IUPAC name is [4-[(Z)-[(Z)-(5,5-dimethyl-4-oxo-1,3-thiazolidin-2-ylidene)hydrazinylidene]methyl]phenyl] 4-propan-2-ylbenzenesulfonate.
| Compound Name | [4-[(Z)-[(Z)-(5,5-dimethyl-4-oxo-1,3-thiazolidin-2-ylidene)hydrazinylidene]methyl]phenyl] 4-propan-2-ylbenzenesulfonate |
|---|---|
| PubChem CID | 171977237 |
| Molecular Formula | C21H23N3O4S2 |
| Molecular Weight | 445.57 g/mol |
| Exact Mass | 445.11 |
| IUPAC Name | [4-[(Z)-[(Z)-(5,5-dimethyl-4-oxo-1,3-thiazolidin-2-ylidene)hydrazinylidene]methyl]phenyl] 4-propan-2-ylbenzenesulfonate |
| SMILES | CC(C)c1ccc(S(=O)(=O)Oc2ccc(/C=N\N=C3\NC(=O)C(C)(C)S3)cc2)cc1 |
| InChI | InChI=1S/C21H23N3O4S2/c1-14(2)16-7-11-18(12-8-16)30(26,27)28-17-9-5-15(6-10-17)13-22-24-20-23-19(25)21(3,4)29-20/h5-14H,1-4H3,(H,23,24,25)/b22-13- |
| InChIKey | CFNUGPQVWDUZBP-XKZIYDEJSA-N |
| XLogP | 3.91 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.57 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|