C17H24O4 — CID 171977726
(3'S,3'aS,9'bR)-3',5'a,9'-trimethylspiro[1,3-dioxolane-2,8'-3a,4,5,6,7,9b-hexahydro-3H-benzo[g][1]benzofuran]-2'-one (PubChem CID 171977726) has the molecular formula C17H24O4 and a molecular weight of 292.38 g/mol. Its IUPAC name is (3'S,3'aS,9'bR)-3',5'a,9'-trimethylspiro[1,3-dioxolane-2,8'-3a,4,5,6,7,9b-hexahydro-3H-benzo[g][1]benzofuran]-2'-one.
| Compound Name | (3'S,3'aS,9'bR)-3',5'a,9'-trimethylspiro[1,3-dioxolane-2,8'-3a,4,5,6,7,9b-hexahydro-3H-benzo[g][1]benzofuran]-2'-one |
|---|---|
| PubChem CID | 171977726 |
| Molecular Formula | C17H24O4 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | (3'S,3'aS,9'bR)-3',5'a,9'-trimethylspiro[1,3-dioxolane-2,8'-3a,4,5,6,7,9b-hexahydro-3H-benzo[g][1]benzofuran]-2'-one |
| SMILES | CC1=C2[C@@H]3OC(=O)[C@@H](C)[C@@H]3CCC2(C)CCC12OCCO2 |
| InChI | InChI=1S/C17H24O4/c1-10-12-4-5-16(3)6-7-17(19-8-9-20-17)11(2)13(16)14(12)21-15(10)18/h10,12,14H,4-9H2,1-3H3/t10-,12-,14+,16?/m0/s1 |
| InChIKey | ZJRHMVGVVISALW-SQWAACOLSA-N |
| XLogP | 2.82 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|