About 2-[(3,5-dibromo-2-pyridinyl)-(4-methyl-3-nitrophenyl)sulfonylcarbamoyl]benzoic acid
2-[(3,5-dibromo-2-pyridinyl)-(4-methyl-3-nitrophenyl)sulfonylcarbamoyl]benzoic acid (PubChem CID 171978474) has the molecular formula C20H13Br2N3O7S
and a molecular weight of 599.21 g/mol. Its IUPAC name is 2-[(3,5-dibromo-2-pyridinyl)-(4-methyl-3-nitrophenyl)sulfonylcarbamoyl]benzoic acid.
Molecular Properties
| Compound Name | 2-[(3,5-dibromo-2-pyridinyl)-(4-methyl-3-nitrophenyl)sulfonylcarbamoyl]benzoic acid |
| PubChem CID | 171978474 |
| Molecular Formula | C20H13Br2N3O7S |
| Molecular Weight | 599.21 g/mol |
| Exact Mass | 596.88 |
| IUPAC Name | 2-[(3,5-dibromo-2-pyridinyl)-(4-methyl-3-nitrophenyl)sulfonylcarbamoyl]benzoic acid |
| SMILES | Cc1ccc(S(=O)(=O)N(C(=O)c2ccccc2C(=O)O)c2ncc(Br)cc2Br)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H13Br2N3O7S/c1-11-6-7-13(9-17(11)25(29)30)33(31,32)24(18-16(22)8-12(21)10-23-18)19(26)14-4-2-3-5-15(14)20(27)28/h2-10H,1H3,(H,27,28) |
| InChIKey | QVQQTZCCTUWYAW-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 147.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 599.21 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[(3,5-dibromo-2-pyridinyl)-(4-methyl-3-nitrophenyl)sulfonylcarbamoyl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3,5-dibromo-2-pyridinyl)-(4-methyl-3-nitrophenyl)sulfonylcarbamoyl]benzoic acid?
The IUPAC name of 2-[(3,5-dibromo-2-pyridinyl)-(4-methyl-3-nitrophenyl)sulfonylcarbamoyl]benzoic acid (CID 171978474) is 2-[(3,5-dibromo-2-pyridinyl)-(4-methyl-3-nitrophenyl)sulfonylcarbamoyl]benzoic acid.
What is the SMILES notation for 2-[(3,5-dibromo-2-pyridinyl)-(4-methyl-3-nitrophenyl)sulfonylcarbamoyl]benzoic acid?
The canonical SMILES for 2-[(3,5-dibromo-2-pyridinyl)-(4-methyl-3-nitrophenyl)sulfonylcarbamoyl]benzoic acid is Cc1ccc(S(=O)(=O)N(C(=O)c2ccccc2C(=O)O)c2ncc(Br)cc2Br)cc1[N+](=O)[O-].
What is the InChIKey of 2-[(3,5-dibromo-2-pyridinyl)-(4-methyl-3-nitrophenyl)sulfonylcarbamoyl]benzoic acid?
The InChIKey is QVQQTZCCTUWYAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H13Br2N3O7S/c1-11-6-7-13(9-17(11)25(29)30)33(31,32)24(18-16(22)8-12(21)10-23-18)19(26)14-4-2-3-5-15(14)20(27)28/h2-10H,1H3,(H,27,28).
What are the key properties of 2-[(3,5-dibromo-2-pyridinyl)-(4-methyl-3-nitrophenyl)sulfonylcarbamoyl]benzoic acid?
2-[(3,5-dibromo-2-pyridinyl)-(4-methyl-3-nitrophenyl)sulfonylcarbamoyl]benzoic acid has a molecular weight of 599.21 g/mol, XLogP of 4.56, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3,5-dibromo-2-pyridinyl)-(4-methyl-3-nitrophenyl)sulfonylcarbamoyl]benzoic acid is sourced from PubChem (CID 171978474), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).