C22H20F6N2O2 — CID 17197875
1-N,4-N-bis[3-(trifluoromethyl)phenyl]cyclohexane-1,4-dicarboxamide (PubChem CID 17197875) has the molecular formula C22H20F6N2O2 and a molecular weight of 458.40 g/mol. Its IUPAC name is 1-N,4-N-bis[3-(trifluoromethyl)phenyl]cyclohexane-1,4-dicarboxamide.
| Compound Name | 1-N,4-N-bis[3-(trifluoromethyl)phenyl]cyclohexane-1,4-dicarboxamide |
|---|---|
| PubChem CID | 17197875 |
| Molecular Formula | C22H20F6N2O2 |
| Molecular Weight | 458.40 g/mol |
| Exact Mass | 458.14 |
| IUPAC Name | 1-N,4-N-bis[3-(trifluoromethyl)phenyl]cyclohexane-1,4-dicarboxamide |
| SMILES | O=C(Nc1cccc(C(F)(F)F)c1)C1CCC(C(=O)Nc2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C22H20F6N2O2/c23-21(24,25)15-3-1-5-17(11-15)29-19(31)13-7-9-14(10-8-13)20(32)30-18-6-2-4-16(12-18)22(26,27)28/h1-6,11-14H,7-10H2,(H,29,31)(H,30,32) |
| InChIKey | WIDQQVOUTVWEQM-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.40 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |