C23H20FN7 — CID 171978862
6-N-benzyl-2-N-[(Z)-(2-fluorophenyl)methylideneamino]-4-N-phenyl-1,3,5-triazine-2,4,6-triamine (PubChem CID 171978862) has the molecular formula C23H20FN7 and a molecular weight of 413.46 g/mol. Its IUPAC name is 6-N-benzyl-2-N-[(Z)-(2-fluorophenyl)methylideneamino]-4-N-phenyl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 6-N-benzyl-2-N-[(Z)-(2-fluorophenyl)methylideneamino]-4-N-phenyl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 171978862 |
| Molecular Formula | C23H20FN7 |
| Molecular Weight | 413.46 g/mol |
| Exact Mass | 413.18 |
| IUPAC Name | 6-N-benzyl-2-N-[(Z)-(2-fluorophenyl)methylideneamino]-4-N-phenyl-1,3,5-triazine-2,4,6-triamine |
| SMILES | Fc1ccccc1/C=N\Nc1nc(NCc2ccccc2)nc(Nc2ccccc2)n1 |
| InChI | InChI=1S/C23H20FN7/c24-20-14-8-7-11-18(20)16-26-31-23-29-21(25-15-17-9-3-1-4-10-17)28-22(30-23)27-19-12-5-2-6-13-19/h1-14,16H,15H2,(H3,25,27,28,29,30,31)/b26-16- |
| InChIKey | ZKRFNBCHINKXSR-QQXSKIMKSA-N |
| XLogP | 4.81 |
| TPSA | 87.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.46 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|