C20H15N5O3S2 — CID 17197901
2-[(3-nitrophenyl)methylsulfanyl]-6-thiophen-2-yl-6,7-dihydro-5H-[1,2,4]triazolo[5,1-b]quinazolin-8-one (PubChem CID 17197901) has the molecular formula C20H15N5O3S2 and a molecular weight of 437.51 g/mol. Its IUPAC name is 2-[(3-nitrophenyl)methylsulfanyl]-6-thiophen-2-yl-6,7-dihydro-5H-[1,2,4]triazolo[5,1-b]quinazolin-8-one.
| Compound Name | 2-[(3-nitrophenyl)methylsulfanyl]-6-thiophen-2-yl-6,7-dihydro-5H-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
|---|---|
| PubChem CID | 17197901 |
| Molecular Formula | C20H15N5O3S2 |
| Molecular Weight | 437.51 g/mol |
| Exact Mass | 437.06 |
| IUPAC Name | 2-[(3-nitrophenyl)methylsulfanyl]-6-thiophen-2-yl-6,7-dihydro-5H-[1,2,4]triazolo[5,1-b]quinazolin-8-one |
| SMILES | O=C1CC(c2cccs2)Cc2nc3nc(SCc4cccc([N+](=O)[O-])c4)nn3cc21 |
| InChI | InChI=1S/C20H15N5O3S2/c26-17-9-13(18-5-2-6-29-18)8-16-15(17)10-24-19(21-16)22-20(23-24)30-11-12-3-1-4-14(7-12)25(27)28/h1-7,10,13H,8-9,11H2 |
| InChIKey | DZKQUECZCRKLGM-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 103.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.51 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|