C4H3N9O5 — CID 171979536
5-(2-hydroxy-5-nitro-1,2,4-triazol-3-yl)-3-nitro-1,2,4-triazol-1-amine (PubChem CID 171979536) has the molecular formula C4H3N9O5 and a molecular weight of 257.13 g/mol. Its IUPAC name is 5-(2-hydroxy-5-nitro-1,2,4-triazol-3-yl)-3-nitro-1,2,4-triazol-1-amine.
| Compound Name | 5-(2-hydroxy-5-nitro-1,2,4-triazol-3-yl)-3-nitro-1,2,4-triazol-1-amine |
|---|---|
| PubChem CID | 171979536 |
| Molecular Formula | C4H3N9O5 |
| Molecular Weight | 257.13 g/mol |
| Exact Mass | 257.03 |
| IUPAC Name | 5-(2-hydroxy-5-nitro-1,2,4-triazol-3-yl)-3-nitro-1,2,4-triazol-1-amine |
| SMILES | Nn1nc([N+](=O)[O-])nc1-c1nc([N+](=O)[O-])nn1O |
| InChI | InChI=1S/C4H3N9O5/c5-10-1(6-3(8-10)12(15)16)2-7-4(13(17)18)9-11(2)14/h14H,5H2 |
| InChIKey | FFECAXFKBYDZJF-UHFFFAOYSA-N |
| XLogP | -1.70 |
| TPSA | 193.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.13 |
| LogP ≤ 5 | -1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|