About (E)-N-(6-nitro-1,3-benzothiazol-2-yl)-1-(5-quinolin-8-ylsulfanylfuran-2-yl)methanimine
(E)-N-(6-nitro-1,3-benzothiazol-2-yl)-1-(5-quinolin-8-ylsulfanylfuran-2-yl)methanimine (PubChem CID 171980296) has the molecular formula C21H12N4O3S2
and a molecular weight of 432.49 g/mol. Its IUPAC name is (E)-N-(6-nitro-1,3-benzothiazol-2-yl)-1-(5-quinolin-8-ylsulfanylfuran-2-yl)methanimine.
Molecular Properties
| Compound Name | (E)-N-(6-nitro-1,3-benzothiazol-2-yl)-1-(5-quinolin-8-ylsulfanylfuran-2-yl)methanimine |
| PubChem CID | 171980296 |
| Molecular Formula | C21H12N4O3S2 |
| Molecular Weight | 432.49 g/mol |
| Exact Mass | 432.04 |
| IUPAC Name | (E)-N-(6-nitro-1,3-benzothiazol-2-yl)-1-(5-quinolin-8-ylsulfanylfuran-2-yl)methanimine |
| SMILES | O=[N+]([O-])c1ccc2nc(/N=C/c3ccc(Sc4cccc5cccnc45)o3)sc2c1 |
| InChI | InChI=1S/C21H12N4O3S2/c26-25(27)14-6-8-16-18(11-14)30-21(24-16)23-12-15-7-9-19(28-15)29-17-5-1-3-13-4-2-10-22-20(13)17/h1-12H/b23-12+ |
| InChIKey | PKHCSUXUZRYQPB-FSJBWODESA-N |
| XLogP | 6.25 |
| TPSA | 94.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 432.49 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (E)-N-(6-nitro-1,3-benzothiazol-2-yl)-1-(5-quinolin-8-ylsulfanylfuran-2-yl)methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-N-(6-nitro-1,3-benzothiazol-2-yl)-1-(5-quinolin-8-ylsulfanylfuran-2-yl)methanimine?
The IUPAC name of (E)-N-(6-nitro-1,3-benzothiazol-2-yl)-1-(5-quinolin-8-ylsulfanylfuran-2-yl)methanimine (CID 171980296) is (E)-N-(6-nitro-1,3-benzothiazol-2-yl)-1-(5-quinolin-8-ylsulfanylfuran-2-yl)methanimine.
What is the SMILES notation for (E)-N-(6-nitro-1,3-benzothiazol-2-yl)-1-(5-quinolin-8-ylsulfanylfuran-2-yl)methanimine?
The canonical SMILES for (E)-N-(6-nitro-1,3-benzothiazol-2-yl)-1-(5-quinolin-8-ylsulfanylfuran-2-yl)methanimine is O=[N+]([O-])c1ccc2nc(/N=C/c3ccc(Sc4cccc5cccnc45)o3)sc2c1.
What is the InChIKey of (E)-N-(6-nitro-1,3-benzothiazol-2-yl)-1-(5-quinolin-8-ylsulfanylfuran-2-yl)methanimine?
The InChIKey is PKHCSUXUZRYQPB-FSJBWODESA-N. The full InChI is InChI=1S/C21H12N4O3S2/c26-25(27)14-6-8-16-18(11-14)30-21(24-16)23-12-15-7-9-19(28-15)29-17-5-1-3-13-4-2-10-22-20(13)17/h1-12H/b23-12+.
What are the key properties of (E)-N-(6-nitro-1,3-benzothiazol-2-yl)-1-(5-quinolin-8-ylsulfanylfuran-2-yl)methanimine?
(E)-N-(6-nitro-1,3-benzothiazol-2-yl)-1-(5-quinolin-8-ylsulfanylfuran-2-yl)methanimine has a molecular weight of 432.49 g/mol, XLogP of 6.25, 5 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-N-(6-nitro-1,3-benzothiazol-2-yl)-1-(5-quinolin-8-ylsulfanylfuran-2-yl)methanimine is sourced from PubChem (CID 171980296), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).