C12H16N2O4 — CID 171980527
phenyl N-[1-(ethylamino)-3-hydroxy-1-oxopropan-2-yl]carbamate (PubChem CID 171980527) has the molecular formula C12H16N2O4 and a molecular weight of 252.27 g/mol. Its IUPAC name is phenyl N-[1-(ethylamino)-3-hydroxy-1-oxopropan-2-yl]carbamate.
| Compound Name | phenyl N-[1-(ethylamino)-3-hydroxy-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 171980527 |
| Molecular Formula | C12H16N2O4 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | phenyl N-[1-(ethylamino)-3-hydroxy-1-oxopropan-2-yl]carbamate |
| SMILES | CCNC(=O)C(CO)NC(=O)Oc1ccccc1 |
| InChI | InChI=1S/C12H16N2O4/c1-2-13-11(16)10(8-15)14-12(17)18-9-6-4-3-5-7-9/h3-7,10,15H,2,8H2,1H3,(H,13,16)(H,14,17) |
| InChIKey | GHWHWGFZSXPDSY-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |