C14H16N4S — CID 171980881
3-ethylsulfanyl-5-propan-2-yl-[1,2,4]triazino[5,6-b]indole (PubChem CID 171980881) has the molecular formula C14H16N4S and a molecular weight of 272.38 g/mol. Its IUPAC name is 3-ethylsulfanyl-5-propan-2-yl-[1,2,4]triazino[5,6-b]indole.
| Compound Name | 3-ethylsulfanyl-5-propan-2-yl-[1,2,4]triazino[5,6-b]indole |
|---|---|
| PubChem CID | 171980881 |
| Molecular Formula | C14H16N4S |
| Molecular Weight | 272.38 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | 3-ethylsulfanyl-5-propan-2-yl-[1,2,4]triazino[5,6-b]indole |
| SMILES | CCSc1nnc2c3ccccc3n(C(C)C)c2n1 |
| InChI | InChI=1S/C14H16N4S/c1-4-19-14-15-13-12(16-17-14)10-7-5-6-8-11(10)18(13)9(2)3/h5-9H,4H2,1-3H3 |
| InChIKey | NZSIIWSJYGMNGH-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.38 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |