C20H22BrN3O2 — CID 171980942
2-bromo-N-[(E)-[4-oxo-4-(4-propan-2-ylanilino)butan-2-ylidene]amino]benzamide (PubChem CID 171980942) has the molecular formula C20H22BrN3O2 and a molecular weight of 416.32 g/mol. Its IUPAC name is 2-bromo-N-[(E)-[4-oxo-4-(4-propan-2-ylanilino)butan-2-ylidene]amino]benzamide.
| Compound Name | 2-bromo-N-[(E)-[4-oxo-4-(4-propan-2-ylanilino)butan-2-ylidene]amino]benzamide |
|---|---|
| PubChem CID | 171980942 |
| Molecular Formula | C20H22BrN3O2 |
| Molecular Weight | 416.32 g/mol |
| Exact Mass | 415.09 |
| IUPAC Name | 2-bromo-N-[(E)-[4-oxo-4-(4-propan-2-ylanilino)butan-2-ylidene]amino]benzamide |
| SMILES | C/C(CC(=O)Nc1ccc(C(C)C)cc1)=N\NC(=O)c1ccccc1Br |
| InChI | InChI=1S/C20H22BrN3O2/c1-13(2)15-8-10-16(11-9-15)22-19(25)12-14(3)23-24-20(26)17-6-4-5-7-18(17)21/h4-11,13H,12H2,1-3H3,(H,22,25)(H,24,26)/b23-14+ |
| InChIKey | YBGOOLSRUJCTSY-OEAKJJBVSA-N |
| XLogP | 4.71 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.32 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|