C11H9F4NO2 — CID 171981687
5-phenyl-3-(1,1,2,2-tetrafluoroethyl)-4H-1,2-oxazol-5-ol (PubChem CID 171981687) has the molecular formula C11H9F4NO2 and a molecular weight of 263.19 g/mol. Its IUPAC name is 5-phenyl-3-(1,1,2,2-tetrafluoroethyl)-4H-1,2-oxazol-5-ol.
| Compound Name | 5-phenyl-3-(1,1,2,2-tetrafluoroethyl)-4H-1,2-oxazol-5-ol |
|---|---|
| PubChem CID | 171981687 |
| Molecular Formula | C11H9F4NO2 |
| Molecular Weight | 263.19 g/mol |
| Exact Mass | 263.06 |
| IUPAC Name | 5-phenyl-3-(1,1,2,2-tetrafluoroethyl)-4H-1,2-oxazol-5-ol |
| SMILES | OC1(c2ccccc2)CC(C(F)(F)C(F)F)=NO1 |
| InChI | InChI=1S/C11H9F4NO2/c12-9(13)11(14,15)8-6-10(17,18-16-8)7-4-2-1-3-5-7/h1-5,9,17H,6H2 |
| InChIKey | RZTWNFJBSBDLPC-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.19 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|