C14H10ClF6N3O2 — CID 171981833
4-chloro-N-[1,1,1,3,3,3-hexafluoro-2-(3-methyl-5-oxo-1,2-dihydropyrazol-4-yl)propan-2-yl]benzamide (PubChem CID 171981833) has the molecular formula C14H10ClF6N3O2 and a molecular weight of 401.69 g/mol. Its IUPAC name is 4-chloro-N-[1,1,1,3,3,3-hexafluoro-2-(3-methyl-5-oxo-1,2-dihydropyrazol-4-yl)propan-2-yl]benzamide.
| Compound Name | 4-chloro-N-[1,1,1,3,3,3-hexafluoro-2-(3-methyl-5-oxo-1,2-dihydropyrazol-4-yl)propan-2-yl]benzamide |
|---|---|
| PubChem CID | 171981833 |
| Molecular Formula | C14H10ClF6N3O2 |
| Molecular Weight | 401.69 g/mol |
| Exact Mass | 401.04 |
| IUPAC Name | 4-chloro-N-[1,1,1,3,3,3-hexafluoro-2-(3-methyl-5-oxo-1,2-dihydropyrazol-4-yl)propan-2-yl]benzamide |
| SMILES | Cc1[nH][nH]c(=O)c1C(NC(=O)c1ccc(Cl)cc1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C14H10ClF6N3O2/c1-6-9(11(26)24-23-6)12(13(16,17)18,14(19,20)21)22-10(25)7-2-4-8(15)5-3-7/h2-5H,1H3,(H,22,25)(H2,23,24,26) |
| InChIKey | LTAAPAPZZDTWAA-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 77.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.69 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |