C24H20FN5O2 — CID 171982102
4-amino-N-[(Z)-[(3-fluorophenyl)-(3-methyl-5-oxo-1-phenyl-4H-pyrazol-4-yl)methylidene]amino]benzamide (PubChem CID 171982102) has the molecular formula C24H20FN5O2 and a molecular weight of 429.46 g/mol. Its IUPAC name is 4-amino-N-[(Z)-[(3-fluorophenyl)-(3-methyl-5-oxo-1-phenyl-4H-pyrazol-4-yl)methylidene]amino]benzamide.
| Compound Name | 4-amino-N-[(Z)-[(3-fluorophenyl)-(3-methyl-5-oxo-1-phenyl-4H-pyrazol-4-yl)methylidene]amino]benzamide |
|---|---|
| PubChem CID | 171982102 |
| Molecular Formula | C24H20FN5O2 |
| Molecular Weight | 429.46 g/mol |
| Exact Mass | 429.16 |
| IUPAC Name | 4-amino-N-[(Z)-[(3-fluorophenyl)-(3-methyl-5-oxo-1-phenyl-4H-pyrazol-4-yl)methylidene]amino]benzamide |
| SMILES | CC1=NN(c2ccccc2)C(=O)C1/C(=N/NC(=O)c1ccc(N)cc1)c1cccc(F)c1 |
| InChI | InChI=1S/C24H20FN5O2/c1-15-21(24(32)30(29-15)20-8-3-2-4-9-20)22(17-6-5-7-18(25)14-17)27-28-23(31)16-10-12-19(26)13-11-16/h2-14,21H,26H2,1H3,(H,28,31)/b27-22+ |
| InChIKey | WAYWTFNGVZRMLS-HPNDGRJYSA-N |
| XLogP | 3.58 |
| TPSA | 100.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.46 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|