C9H9N5O4 — CID 171982597
6-hydroxy-5-[(3-methyl-5-oxo-1,2-dihydropyrazol-4-yl)iminomethyl]-1H-pyrimidine-2,4-dione (PubChem CID 171982597) has the molecular formula C9H9N5O4 and a molecular weight of 251.20 g/mol. Its IUPAC name is 6-hydroxy-5-[(3-methyl-5-oxo-1,2-dihydropyrazol-4-yl)iminomethyl]-1H-pyrimidine-2,4-dione.
| Compound Name | 6-hydroxy-5-[(3-methyl-5-oxo-1,2-dihydropyrazol-4-yl)iminomethyl]-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 171982597 |
| Molecular Formula | C9H9N5O4 |
| Molecular Weight | 251.20 g/mol |
| Exact Mass | 251.07 |
| IUPAC Name | 6-hydroxy-5-[(3-methyl-5-oxo-1,2-dihydropyrazol-4-yl)iminomethyl]-1H-pyrimidine-2,4-dione |
| SMILES | Cc1[nH][nH]c(=O)c1/N=C/c1c(O)[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C9H9N5O4/c1-3-5(8(17)14-13-3)10-2-4-6(15)11-9(18)12-7(4)16/h2H,1H3,(H2,13,14,17)(H3,11,12,15,16,18)/b10-2+ |
| InChIKey | WYVKZAHNDYRHNJ-WTDSWWLTSA-N |
| XLogP | -1.16 |
| TPSA | 146.96 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.20 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|