About 2-N,5-N-bis[(2-hydroxy-1H-indol-3-yl)imino]pyridine-2,5-dicarboxamide
2-N,5-N-bis[(2-hydroxy-1H-indol-3-yl)imino]pyridine-2,5-dicarboxamide (PubChem CID 171983173) has the molecular formula C23H15N7O4
and a molecular weight of 453.42 g/mol. Its IUPAC name is 2-N,5-N-bis[(2-hydroxy-1H-indol-3-yl)imino]pyridine-2,5-dicarboxamide.
Molecular Properties
| Compound Name | 2-N,5-N-bis[(2-hydroxy-1H-indol-3-yl)imino]pyridine-2,5-dicarboxamide |
| PubChem CID | 171983173 |
| Molecular Formula | C23H15N7O4 |
| Molecular Weight | 453.42 g/mol |
| Exact Mass | 453.12 |
| IUPAC Name | 2-N,5-N-bis[(2-hydroxy-1H-indol-3-yl)imino]pyridine-2,5-dicarboxamide |
| SMILES | O=C(/N=N/c1c(O)[nH]c2ccccc12)c1ccc(C(=O)/N=N/c2c(O)[nH]c3ccccc23)nc1 |
| InChI | InChI=1S/C23H15N7O4/c31-20(29-27-18-13-5-1-3-7-15(13)25-22(18)33)12-9-10-17(24-11-12)21(32)30-28-19-14-6-2-4-8-16(14)26-23(19)34/h1-11,25-26,33-34H/b29-27+,30-28+ |
| InChIKey | CKTYZGLZMCQJIW-QAVVBOBSSA-N |
| XLogP | 5.30 |
| TPSA | 168.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 453.42 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-N,5-N-bis[(2-hydroxy-1H-indol-3-yl)imino]pyridine-2,5-dicarboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N,5-N-bis[(2-hydroxy-1H-indol-3-yl)imino]pyridine-2,5-dicarboxamide?
The IUPAC name of 2-N,5-N-bis[(2-hydroxy-1H-indol-3-yl)imino]pyridine-2,5-dicarboxamide (CID 171983173) is 2-N,5-N-bis[(2-hydroxy-1H-indol-3-yl)imino]pyridine-2,5-dicarboxamide.
What is the SMILES notation for 2-N,5-N-bis[(2-hydroxy-1H-indol-3-yl)imino]pyridine-2,5-dicarboxamide?
The canonical SMILES for 2-N,5-N-bis[(2-hydroxy-1H-indol-3-yl)imino]pyridine-2,5-dicarboxamide is O=C(/N=N/c1c(O)[nH]c2ccccc12)c1ccc(C(=O)/N=N/c2c(O)[nH]c3ccccc23)nc1.
What is the InChIKey of 2-N,5-N-bis[(2-hydroxy-1H-indol-3-yl)imino]pyridine-2,5-dicarboxamide?
The InChIKey is CKTYZGLZMCQJIW-QAVVBOBSSA-N. The full InChI is InChI=1S/C23H15N7O4/c31-20(29-27-18-13-5-1-3-7-15(13)25-22(18)33)12-9-10-17(24-11-12)21(32)30-28-19-14-6-2-4-8-16(14)26-23(19)34/h1-11,25-26,33-34H/b29-27+,30-28+.
What are the key properties of 2-N,5-N-bis[(2-hydroxy-1H-indol-3-yl)imino]pyridine-2,5-dicarboxamide?
2-N,5-N-bis[(2-hydroxy-1H-indol-3-yl)imino]pyridine-2,5-dicarboxamide has a molecular weight of 453.42 g/mol, XLogP of 5.30, 4 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N,5-N-bis[(2-hydroxy-1H-indol-3-yl)imino]pyridine-2,5-dicarboxamide is sourced from PubChem (CID 171983173), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).