C17H15F3N4O2 — CID 171983329
butyl 5-phenyl-7-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxylate (PubChem CID 171983329) has the molecular formula C17H15F3N4O2 and a molecular weight of 364.33 g/mol. Its IUPAC name is butyl 5-phenyl-7-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxylate.
| Compound Name | butyl 5-phenyl-7-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxylate |
|---|---|
| PubChem CID | 171983329 |
| Molecular Formula | C17H15F3N4O2 |
| Molecular Weight | 364.33 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | butyl 5-phenyl-7-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyrimidine-2-carboxylate |
| SMILES | CCCCOC(=O)c1nc2nc(-c3ccccc3)cc(C(F)(F)F)n2n1 |
| InChI | InChI=1S/C17H15F3N4O2/c1-2-3-9-26-15(25)14-22-16-21-12(11-7-5-4-6-8-11)10-13(17(18,19)20)24(16)23-14/h4-8,10H,2-3,9H2,1H3 |
| InChIKey | VKAVMYQWVMXJQF-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 69.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.33 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|