C16H19F4N — CID 171983502
N,N-diethyl-3,4,5,6-tetrafluorotricyclo[6.2.2.02,7]dodeca-2(7),3,5-trien-1-amine (PubChem CID 171983502) has the molecular formula C16H19F4N and a molecular weight of 301.33 g/mol. Its IUPAC name is N,N-diethyl-3,4,5,6-tetrafluorotricyclo[6.2.2.02,7]dodeca-2(7),3,5-trien-1-amine.
| Compound Name | N,N-diethyl-3,4,5,6-tetrafluorotricyclo[6.2.2.02,7]dodeca-2(7),3,5-trien-1-amine |
|---|---|
| PubChem CID | 171983502 |
| Molecular Formula | C16H19F4N |
| Molecular Weight | 301.33 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | N,N-diethyl-3,4,5,6-tetrafluorotricyclo[6.2.2.02,7]dodeca-2(7),3,5-trien-1-amine |
| SMILES | CCN(CC)C12CCC(CC1)c1c(F)c(F)c(F)c(F)c12 |
| InChI | InChI=1S/C16H19F4N/c1-3-21(4-2)16-7-5-9(6-8-16)10-11(16)13(18)15(20)14(19)12(10)17/h9H,3-8H2,1-2H3 |
| InChIKey | MWSBUISYVCMSBE-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.33 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|