C12H10N3O2- — CID 171983807
2-[1-(2-cyanoethyl)benzimidazol-2-yl]acetate (PubChem CID 171983807) has the molecular formula C12H10N3O2- and a molecular weight of 228.23 g/mol. Its IUPAC name is 2-[1-(2-cyanoethyl)benzimidazol-2-yl]acetate.
| Compound Name | 2-[1-(2-cyanoethyl)benzimidazol-2-yl]acetate |
|---|---|
| PubChem CID | 171983807 |
| Molecular Formula | C12H10N3O2- |
| Molecular Weight | 228.23 g/mol |
| Exact Mass | 228.08 |
| IUPAC Name | 2-[1-(2-cyanoethyl)benzimidazol-2-yl]acetate |
| SMILES | N#CCCn1c(CC(=O)[O-])nc2ccccc21 |
| InChI | InChI=1S/C12H11N3O2/c13-6-3-7-15-10-5-2-1-4-9(10)14-11(15)8-12(16)17/h1-2,4-5H,3,7-8H2,(H,16,17)/p-1 |
| InChIKey | SXUXHWJMEYNDJF-UHFFFAOYSA-M |
| XLogP | 0.24 |
| TPSA | 81.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.23 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |