About ethyl N-[(E)-2-(5,6-dihydro-4H-phenalen-1-yliminomethyl)-3-hydroxybut-2-enoyl]carbamate
ethyl N-[(E)-2-(5,6-dihydro-4H-phenalen-1-yliminomethyl)-3-hydroxybut-2-enoyl]carbamate (PubChem CID 171984226) has the molecular formula C21H22N2O4
and a molecular weight of 366.42 g/mol. Its IUPAC name is ethyl N-[(E)-2-(5,6-dihydro-4H-phenalen-1-yliminomethyl)-3-hydroxybut-2-enoyl]carbamate.
Molecular Properties
| Compound Name | ethyl N-[(E)-2-(5,6-dihydro-4H-phenalen-1-yliminomethyl)-3-hydroxybut-2-enoyl]carbamate |
| PubChem CID | 171984226 |
| Molecular Formula | C21H22N2O4 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | ethyl N-[(E)-2-(5,6-dihydro-4H-phenalen-1-yliminomethyl)-3-hydroxybut-2-enoyl]carbamate |
| SMILES | CCOC(=O)NC(=O)C(/C=N/c1ccc2c3c(cccc13)CCC2)=C(\C)O |
| InChI | InChI=1S/C21H22N2O4/c1-3-27-21(26)23-20(25)17(13(2)24)12-22-18-11-10-15-7-4-6-14-8-5-9-16(18)19(14)15/h5,8-12,24H,3-4,6-7H2,1-2H3,(H,23,25,26)/b17-13+,22-12+ |
| InChIKey | IEFHAHABDUCORG-IVHPCTTCSA-N |
| XLogP | 4.14 |
| TPSA | 87.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl N-[(E)-2-(5,6-dihydro-4H-phenalen-1-yliminomethyl)-3-hydroxybut-2-enoyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl N-[(E)-2-(5,6-dihydro-4H-phenalen-1-yliminomethyl)-3-hydroxybut-2-enoyl]carbamate?
The IUPAC name of ethyl N-[(E)-2-(5,6-dihydro-4H-phenalen-1-yliminomethyl)-3-hydroxybut-2-enoyl]carbamate (CID 171984226) is ethyl N-[(E)-2-(5,6-dihydro-4H-phenalen-1-yliminomethyl)-3-hydroxybut-2-enoyl]carbamate.
What is the SMILES notation for ethyl N-[(E)-2-(5,6-dihydro-4H-phenalen-1-yliminomethyl)-3-hydroxybut-2-enoyl]carbamate?
The canonical SMILES for ethyl N-[(E)-2-(5,6-dihydro-4H-phenalen-1-yliminomethyl)-3-hydroxybut-2-enoyl]carbamate is CCOC(=O)NC(=O)C(/C=N/c1ccc2c3c(cccc13)CCC2)=C(\C)O.
What is the InChIKey of ethyl N-[(E)-2-(5,6-dihydro-4H-phenalen-1-yliminomethyl)-3-hydroxybut-2-enoyl]carbamate?
The InChIKey is IEFHAHABDUCORG-IVHPCTTCSA-N. The full InChI is InChI=1S/C21H22N2O4/c1-3-27-21(26)23-20(25)17(13(2)24)12-22-18-11-10-15-7-4-6-14-8-5-9-16(18)19(14)15/h5,8-12,24H,3-4,6-7H2,1-2H3,(H,23,25,26)/b17-13+,22-12+.
What are the key properties of ethyl N-[(E)-2-(5,6-dihydro-4H-phenalen-1-yliminomethyl)-3-hydroxybut-2-enoyl]carbamate?
ethyl N-[(E)-2-(5,6-dihydro-4H-phenalen-1-yliminomethyl)-3-hydroxybut-2-enoyl]carbamate has a molecular weight of 366.42 g/mol, XLogP of 4.14, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl N-[(E)-2-(5,6-dihydro-4H-phenalen-1-yliminomethyl)-3-hydroxybut-2-enoyl]carbamate is sourced from PubChem (CID 171984226), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).