C17H13N3O4 — CID 171984265
4-[(2-methyl-4-nitrophenyl)iminomethyl]-3-phenyl-2H-1,2-oxazol-5-one (PubChem CID 171984265) has the molecular formula C17H13N3O4 and a molecular weight of 323.31 g/mol. Its IUPAC name is 4-[(2-methyl-4-nitrophenyl)iminomethyl]-3-phenyl-2H-1,2-oxazol-5-one.
| Compound Name | 4-[(2-methyl-4-nitrophenyl)iminomethyl]-3-phenyl-2H-1,2-oxazol-5-one |
|---|---|
| PubChem CID | 171984265 |
| Molecular Formula | C17H13N3O4 |
| Molecular Weight | 323.31 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | 4-[(2-methyl-4-nitrophenyl)iminomethyl]-3-phenyl-2H-1,2-oxazol-5-one |
| SMILES | Cc1cc([N+](=O)[O-])ccc1/N=C/c1c(-c2ccccc2)[nH]oc1=O |
| InChI | InChI=1S/C17H13N3O4/c1-11-9-13(20(22)23)7-8-15(11)18-10-14-16(19-24-17(14)21)12-5-3-2-4-6-12/h2-10,19H,1H3/b18-10+ |
| InChIKey | DZZUXKJESBLMEB-VCHYOVAHSA-N |
| XLogP | 3.60 |
| TPSA | 101.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.31 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|