About ethyl N-(1-cycloheptyl-2,4-dioxopyrimidine-5-carbonyl)carbamate
ethyl N-(1-cycloheptyl-2,4-dioxopyrimidine-5-carbonyl)carbamate (PubChem CID 171984285) has the molecular formula C15H21N3O5
and a molecular weight of 323.35 g/mol. Its IUPAC name is ethyl N-(1-cycloheptyl-2,4-dioxopyrimidine-5-carbonyl)carbamate.
Molecular Properties
| Compound Name | ethyl N-(1-cycloheptyl-2,4-dioxopyrimidine-5-carbonyl)carbamate |
| PubChem CID | 171984285 |
| Molecular Formula | C15H21N3O5 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | ethyl N-(1-cycloheptyl-2,4-dioxopyrimidine-5-carbonyl)carbamate |
| SMILES | CCOC(=O)NC(=O)c1cn(C2CCCCCC2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C15H21N3O5/c1-2-23-15(22)17-13(20)11-9-18(14(21)16-12(11)19)10-7-5-3-4-6-8-10/h9-10H,2-8H2,1H3,(H,16,19,21)(H,17,20,22) |
| InChIKey | MOEMRDIGIWEOFY-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 110.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl N-(1-cycloheptyl-2,4-dioxopyrimidine-5-carbonyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl N-(1-cycloheptyl-2,4-dioxopyrimidine-5-carbonyl)carbamate?
The IUPAC name of ethyl N-(1-cycloheptyl-2,4-dioxopyrimidine-5-carbonyl)carbamate (CID 171984285) is ethyl N-(1-cycloheptyl-2,4-dioxopyrimidine-5-carbonyl)carbamate.
What is the SMILES notation for ethyl N-(1-cycloheptyl-2,4-dioxopyrimidine-5-carbonyl)carbamate?
The canonical SMILES for ethyl N-(1-cycloheptyl-2,4-dioxopyrimidine-5-carbonyl)carbamate is CCOC(=O)NC(=O)c1cn(C2CCCCCC2)c(=O)[nH]c1=O.
What is the InChIKey of ethyl N-(1-cycloheptyl-2,4-dioxopyrimidine-5-carbonyl)carbamate?
The InChIKey is MOEMRDIGIWEOFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21N3O5/c1-2-23-15(22)17-13(20)11-9-18(14(21)16-12(11)19)10-7-5-3-4-6-8-10/h9-10H,2-8H2,1H3,(H,16,19,21)(H,17,20,22).
What are the key properties of ethyl N-(1-cycloheptyl-2,4-dioxopyrimidine-5-carbonyl)carbamate?
ethyl N-(1-cycloheptyl-2,4-dioxopyrimidine-5-carbonyl)carbamate has a molecular weight of 323.35 g/mol, XLogP of 1.32, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl N-(1-cycloheptyl-2,4-dioxopyrimidine-5-carbonyl)carbamate is sourced from PubChem (CID 171984285), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).