C13H12Cl2N2OS2 — CID 171984295
5-[N-[(3,4-dichlorophenyl)methyl]-C-ethylcarbonimidoyl]-4-hydroxy-3H-1,3-thiazole-2-thione (PubChem CID 171984295) has the molecular formula C13H12Cl2N2OS2 and a molecular weight of 347.29 g/mol. Its IUPAC name is 5-[N-[(3,4-dichlorophenyl)methyl]-C-ethylcarbonimidoyl]-4-hydroxy-3H-1,3-thiazole-2-thione.
| Compound Name | 5-[N-[(3,4-dichlorophenyl)methyl]-C-ethylcarbonimidoyl]-4-hydroxy-3H-1,3-thiazole-2-thione |
|---|---|
| PubChem CID | 171984295 |
| Molecular Formula | C13H12Cl2N2OS2 |
| Molecular Weight | 347.29 g/mol |
| Exact Mass | 345.98 |
| IUPAC Name | 5-[N-[(3,4-dichlorophenyl)methyl]-C-ethylcarbonimidoyl]-4-hydroxy-3H-1,3-thiazole-2-thione |
| SMILES | CC/C(=N\Cc1ccc(Cl)c(Cl)c1)c1sc(=S)[nH]c1O |
| InChI | InChI=1S/C13H12Cl2N2OS2/c1-2-10(11-12(18)17-13(19)20-11)16-6-7-3-4-8(14)9(15)5-7/h3-5,18H,2,6H2,1H3,(H,17,19)/b16-10+ |
| InChIKey | IGZBPYVLLIHMRW-MHWRWJLKSA-N |
| XLogP | 5.22 |
| TPSA | 48.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.29 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|