C17H15N5O — CID 17198451
2,4-diamino-5-phenyl-8,9-dihydro-7H-pyrimido[4,5-b]quinolin-6-one (PubChem CID 17198451) has the molecular formula C17H15N5O and a molecular weight of 305.34 g/mol. Its IUPAC name is 2,4-diamino-5-phenyl-8,9-dihydro-7H-pyrimido[4,5-b]quinolin-6-one.
| Compound Name | 2,4-diamino-5-phenyl-8,9-dihydro-7H-pyrimido[4,5-b]quinolin-6-one |
|---|---|
| PubChem CID | 17198451 |
| Molecular Formula | C17H15N5O |
| Molecular Weight | 305.34 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | 2,4-diamino-5-phenyl-8,9-dihydro-7H-pyrimido[4,5-b]quinolin-6-one |
| SMILES | Nc1nc(N)c2c(-c3ccccc3)c3c(nc2n1)CCCC3=O |
| InChI | InChI=1S/C17H15N5O/c18-15-14-12(9-5-2-1-3-6-9)13-10(7-4-8-11(13)23)20-16(14)22-17(19)21-15/h1-3,5-6H,4,7-8H2,(H4,18,19,20,21,22) |
| InChIKey | UXDMWUGESLOAAI-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 107.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.34 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |