C19H10N6 — CID 171984585
6-imino-3-phenylpyridazino[1,6-a]quinazoline-2,4-dicarbonitrile (PubChem CID 171984585) has the molecular formula C19H10N6 and a molecular weight of 322.33 g/mol. Its IUPAC name is 6-imino-3-phenylpyridazino[1,6-a]quinazoline-2,4-dicarbonitrile.
| Compound Name | 6-imino-3-phenylpyridazino[1,6-a]quinazoline-2,4-dicarbonitrile |
|---|---|
| PubChem CID | 171984585 |
| Molecular Formula | C19H10N6 |
| Molecular Weight | 322.33 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | 6-imino-3-phenylpyridazino[1,6-a]quinazoline-2,4-dicarbonitrile |
| SMILES | [H]/N=c1\nc2c(C#N)c(-c3ccccc3)c(C#N)nn2c2ccccc12 |
| InChI | InChI=1S/C19H10N6/c20-10-14-17(12-6-2-1-3-7-12)15(11-21)24-25-16-9-5-4-8-13(16)18(22)23-19(14)25/h1-9,22H/b22-18- |
| InChIKey | YSBYORAFBJNZLZ-PYCFMQQDSA-N |
| XLogP | 2.77 |
| TPSA | 101.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.33 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|