C23H29F3N4 — CID 171984803
6-methyl-5-[3-methyl-3-[4-(trifluoromethyl)phenyl]but-1-ynyl]-2-N,4-N-dipropylpyrimidine-2,4-diamine (PubChem CID 171984803) has the molecular formula C23H29F3N4 and a molecular weight of 418.51 g/mol. Its IUPAC name is 6-methyl-5-[3-methyl-3-[4-(trifluoromethyl)phenyl]but-1-ynyl]-2-N,4-N-dipropylpyrimidine-2,4-diamine.
| Compound Name | 6-methyl-5-[3-methyl-3-[4-(trifluoromethyl)phenyl]but-1-ynyl]-2-N,4-N-dipropylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 171984803 |
| Molecular Formula | C23H29F3N4 |
| Molecular Weight | 418.51 g/mol |
| Exact Mass | 418.23 |
| IUPAC Name | 6-methyl-5-[3-methyl-3-[4-(trifluoromethyl)phenyl]but-1-ynyl]-2-N,4-N-dipropylpyrimidine-2,4-diamine |
| SMILES | CCCNc1nc(C)c(C#CC(C)(C)c2ccc(C(F)(F)F)cc2)c(NCCC)n1 |
| InChI | InChI=1S/C23H29F3N4/c1-6-14-27-20-19(16(3)29-21(30-20)28-15-7-2)12-13-22(4,5)17-8-10-18(11-9-17)23(24,25)26/h8-11H,6-7,14-15H2,1-5H3,(H2,27,28,29,30) |
| InChIKey | OYZZAKQSPUTINL-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.51 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|