About [4-chloro-3-[(4,4-dimethyl-3-oxo-1,2-oxazolidin-2-yl)methyl]phenyl] N-methylcarbamate
[4-chloro-3-[(4,4-dimethyl-3-oxo-1,2-oxazolidin-2-yl)methyl]phenyl] N-methylcarbamate (PubChem CID 171984971) has the molecular formula C14H17ClN2O4
and a molecular weight of 312.75 g/mol. Its IUPAC name is [4-chloro-3-[(4,4-dimethyl-3-oxo-1,2-oxazolidin-2-yl)methyl]phenyl] N-methylcarbamate.
Molecular Properties
| Compound Name | [4-chloro-3-[(4,4-dimethyl-3-oxo-1,2-oxazolidin-2-yl)methyl]phenyl] N-methylcarbamate |
| PubChem CID | 171984971 |
| Molecular Formula | C14H17ClN2O4 |
| Molecular Weight | 312.75 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | [4-chloro-3-[(4,4-dimethyl-3-oxo-1,2-oxazolidin-2-yl)methyl]phenyl] N-methylcarbamate |
| SMILES | CNC(=O)Oc1ccc(Cl)c(CN2OCC(C)(C)C2=O)c1 |
| InChI | InChI=1S/C14H17ClN2O4/c1-14(2)8-20-17(12(14)18)7-9-6-10(4-5-11(9)15)21-13(19)16-3/h4-6H,7-8H2,1-3H3,(H,16,19) |
| InChIKey | WBBXAIXWWIFOMD-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.75 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [4-chloro-3-[(4,4-dimethyl-3-oxo-1,2-oxazolidin-2-yl)methyl]phenyl] N-methylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-chloro-3-[(4,4-dimethyl-3-oxo-1,2-oxazolidin-2-yl)methyl]phenyl] N-methylcarbamate?
The IUPAC name of [4-chloro-3-[(4,4-dimethyl-3-oxo-1,2-oxazolidin-2-yl)methyl]phenyl] N-methylcarbamate (CID 171984971) is [4-chloro-3-[(4,4-dimethyl-3-oxo-1,2-oxazolidin-2-yl)methyl]phenyl] N-methylcarbamate.
What is the SMILES notation for [4-chloro-3-[(4,4-dimethyl-3-oxo-1,2-oxazolidin-2-yl)methyl]phenyl] N-methylcarbamate?
The canonical SMILES for [4-chloro-3-[(4,4-dimethyl-3-oxo-1,2-oxazolidin-2-yl)methyl]phenyl] N-methylcarbamate is CNC(=O)Oc1ccc(Cl)c(CN2OCC(C)(C)C2=O)c1.
What is the InChIKey of [4-chloro-3-[(4,4-dimethyl-3-oxo-1,2-oxazolidin-2-yl)methyl]phenyl] N-methylcarbamate?
The InChIKey is WBBXAIXWWIFOMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17ClN2O4/c1-14(2)8-20-17(12(14)18)7-9-6-10(4-5-11(9)15)21-13(19)16-3/h4-6H,7-8H2,1-3H3,(H,16,19).
What are the key properties of [4-chloro-3-[(4,4-dimethyl-3-oxo-1,2-oxazolidin-2-yl)methyl]phenyl] N-methylcarbamate?
[4-chloro-3-[(4,4-dimethyl-3-oxo-1,2-oxazolidin-2-yl)methyl]phenyl] N-methylcarbamate has a molecular weight of 312.75 g/mol, XLogP of 2.36, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-chloro-3-[(4,4-dimethyl-3-oxo-1,2-oxazolidin-2-yl)methyl]phenyl] N-methylcarbamate is sourced from PubChem (CID 171984971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).