About 2-methyl-4-(3-methylphenyl)-5-(trifluoromethyl)-1,2,4-triazole-3-thione
2-methyl-4-(3-methylphenyl)-5-(trifluoromethyl)-1,2,4-triazole-3-thione (PubChem CID 171985096) has the molecular formula C11H10F3N3S
and a molecular weight of 273.28 g/mol. Its IUPAC name is 2-methyl-4-(3-methylphenyl)-5-(trifluoromethyl)-1,2,4-triazole-3-thione.
Molecular Properties
| Compound Name | 2-methyl-4-(3-methylphenyl)-5-(trifluoromethyl)-1,2,4-triazole-3-thione |
| PubChem CID | 171985096 |
| Molecular Formula | C11H10F3N3S |
| Molecular Weight | 273.28 g/mol |
| Exact Mass | 273.05 |
| IUPAC Name | 2-methyl-4-(3-methylphenyl)-5-(trifluoromethyl)-1,2,4-triazole-3-thione |
| SMILES | Cc1cccc(-n2c(C(F)(F)F)nn(C)c2=S)c1 |
| InChI | InChI=1S/C11H10F3N3S/c1-7-4-3-5-8(6-7)17-9(11(12,13)14)15-16(2)10(17)18/h3-6H,1-2H3 |
| InChIKey | MEMLVOHSNQZYSJ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 22.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.28 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-4-(3-methylphenyl)-5-(trifluoromethyl)-1,2,4-triazole-3-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-4-(3-methylphenyl)-5-(trifluoromethyl)-1,2,4-triazole-3-thione?
The IUPAC name of 2-methyl-4-(3-methylphenyl)-5-(trifluoromethyl)-1,2,4-triazole-3-thione (CID 171985096) is 2-methyl-4-(3-methylphenyl)-5-(trifluoromethyl)-1,2,4-triazole-3-thione.
What is the SMILES notation for 2-methyl-4-(3-methylphenyl)-5-(trifluoromethyl)-1,2,4-triazole-3-thione?
The canonical SMILES for 2-methyl-4-(3-methylphenyl)-5-(trifluoromethyl)-1,2,4-triazole-3-thione is Cc1cccc(-n2c(C(F)(F)F)nn(C)c2=S)c1.
What is the InChIKey of 2-methyl-4-(3-methylphenyl)-5-(trifluoromethyl)-1,2,4-triazole-3-thione?
The InChIKey is MEMLVOHSNQZYSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10F3N3S/c1-7-4-3-5-8(6-7)17-9(11(12,13)14)15-16(2)10(17)18/h3-6H,1-2H3.
What are the key properties of 2-methyl-4-(3-methylphenyl)-5-(trifluoromethyl)-1,2,4-triazole-3-thione?
2-methyl-4-(3-methylphenyl)-5-(trifluoromethyl)-1,2,4-triazole-3-thione has a molecular weight of 273.28 g/mol, XLogP of 3.27, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-4-(3-methylphenyl)-5-(trifluoromethyl)-1,2,4-triazole-3-thione is sourced from PubChem (CID 171985096), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).