About 1-(2-methyl-1,3-dioxolan-2-yl)ethyl N-(4-chloro-2-fluoro-5-propan-2-yloxyphenyl)carbamate
1-(2-methyl-1,3-dioxolan-2-yl)ethyl N-(4-chloro-2-fluoro-5-propan-2-yloxyphenyl)carbamate (PubChem CID 171985155) has the molecular formula C16H21ClFNO5
and a molecular weight of 361.80 g/mol. Its IUPAC name is 1-(2-methyl-1,3-dioxolan-2-yl)ethyl N-(4-chloro-2-fluoro-5-propan-2-yloxyphenyl)carbamate.
Molecular Properties
| Compound Name | 1-(2-methyl-1,3-dioxolan-2-yl)ethyl N-(4-chloro-2-fluoro-5-propan-2-yloxyphenyl)carbamate |
| PubChem CID | 171985155 |
| Molecular Formula | C16H21ClFNO5 |
| Molecular Weight | 361.80 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | 1-(2-methyl-1,3-dioxolan-2-yl)ethyl N-(4-chloro-2-fluoro-5-propan-2-yloxyphenyl)carbamate |
| SMILES | CC(C)Oc1cc(NC(=O)OC(C)C2(C)OCCO2)c(F)cc1Cl |
| InChI | InChI=1S/C16H21ClFNO5/c1-9(2)23-14-8-13(12(18)7-11(14)17)19-15(20)24-10(3)16(4)21-5-6-22-16/h7-10H,5-6H2,1-4H3,(H,19,20) |
| InChIKey | PISRRHJSDWOWBO-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.80 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(2-methyl-1,3-dioxolan-2-yl)ethyl N-(4-chloro-2-fluoro-5-propan-2-yloxyphenyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-methyl-1,3-dioxolan-2-yl)ethyl N-(4-chloro-2-fluoro-5-propan-2-yloxyphenyl)carbamate?
The IUPAC name of 1-(2-methyl-1,3-dioxolan-2-yl)ethyl N-(4-chloro-2-fluoro-5-propan-2-yloxyphenyl)carbamate (CID 171985155) is 1-(2-methyl-1,3-dioxolan-2-yl)ethyl N-(4-chloro-2-fluoro-5-propan-2-yloxyphenyl)carbamate.
What is the SMILES notation for 1-(2-methyl-1,3-dioxolan-2-yl)ethyl N-(4-chloro-2-fluoro-5-propan-2-yloxyphenyl)carbamate?
The canonical SMILES for 1-(2-methyl-1,3-dioxolan-2-yl)ethyl N-(4-chloro-2-fluoro-5-propan-2-yloxyphenyl)carbamate is CC(C)Oc1cc(NC(=O)OC(C)C2(C)OCCO2)c(F)cc1Cl.
What is the InChIKey of 1-(2-methyl-1,3-dioxolan-2-yl)ethyl N-(4-chloro-2-fluoro-5-propan-2-yloxyphenyl)carbamate?
The InChIKey is PISRRHJSDWOWBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21ClFNO5/c1-9(2)23-14-8-13(12(18)7-11(14)17)19-15(20)24-10(3)16(4)21-5-6-22-16/h7-10H,5-6H2,1-4H3,(H,19,20).
What are the key properties of 1-(2-methyl-1,3-dioxolan-2-yl)ethyl N-(4-chloro-2-fluoro-5-propan-2-yloxyphenyl)carbamate?
1-(2-methyl-1,3-dioxolan-2-yl)ethyl N-(4-chloro-2-fluoro-5-propan-2-yloxyphenyl)carbamate has a molecular weight of 361.80 g/mol, XLogP of 3.97, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-methyl-1,3-dioxolan-2-yl)ethyl N-(4-chloro-2-fluoro-5-propan-2-yloxyphenyl)carbamate is sourced from PubChem (CID 171985155), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).