C20H16FNO2 — CID 171985814
(4Z)-4-[(2E)-2-benzylidenebutylidene]-2-(2-fluorophenyl)-1,3-oxazol-5-one (PubChem CID 171985814) has the molecular formula C20H16FNO2 and a molecular weight of 321.35 g/mol. Its IUPAC name is (4Z)-4-[(2E)-2-benzylidenebutylidene]-2-(2-fluorophenyl)-1,3-oxazol-5-one.
| Compound Name | (4Z)-4-[(2E)-2-benzylidenebutylidene]-2-(2-fluorophenyl)-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 171985814 |
| Molecular Formula | C20H16FNO2 |
| Molecular Weight | 321.35 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | (4Z)-4-[(2E)-2-benzylidenebutylidene]-2-(2-fluorophenyl)-1,3-oxazol-5-one |
| SMILES | CCC(/C=C1\N=C(c2ccccc2F)OC1=O)=C\c1ccccc1 |
| InChI | InChI=1S/C20H16FNO2/c1-2-14(12-15-8-4-3-5-9-15)13-18-20(23)24-19(22-18)16-10-6-7-11-17(16)21/h3-13H,2H2,1H3/b14-12+,18-13- |
| InChIKey | FYXZLVMYVFLELX-COVZNBLNSA-N |
| XLogP | 4.51 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.35 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|