C16H13Cl2F3N2O2 — CID 171985825
2-(4-chloro-3-methylphenoxy)-N-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]propanamide (PubChem CID 171985825) has the molecular formula C16H13Cl2F3N2O2 and a molecular weight of 393.19 g/mol. Its IUPAC name is 2-(4-chloro-3-methylphenoxy)-N-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]propanamide.
| Compound Name | 2-(4-chloro-3-methylphenoxy)-N-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]propanamide |
|---|---|
| PubChem CID | 171985825 |
| Molecular Formula | C16H13Cl2F3N2O2 |
| Molecular Weight | 393.19 g/mol |
| Exact Mass | 392.03 |
| IUPAC Name | 2-(4-chloro-3-methylphenoxy)-N-[3-chloro-5-(trifluoromethyl)-2-pyridinyl]propanamide |
| SMILES | Cc1cc(OC(C)C(=O)Nc2ncc(C(F)(F)F)cc2Cl)ccc1Cl |
| InChI | InChI=1S/C16H13Cl2F3N2O2/c1-8-5-11(3-4-12(8)17)25-9(2)15(24)23-14-13(18)6-10(7-22-14)16(19,20)21/h3-7,9H,1-2H3,(H,22,23,24) |
| InChIKey | LCSOEFVTQYSXFO-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.19 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |