About 1,1-bis(1-methylimidazol-2-yl)-3,3-diphenylprop-2-en-1-ol
1,1-bis(1-methylimidazol-2-yl)-3,3-diphenylprop-2-en-1-ol (PubChem CID 171986160) has the molecular formula C23H22N4O
and a molecular weight of 370.46 g/mol. Its IUPAC name is 1,1-bis(1-methylimidazol-2-yl)-3,3-diphenylprop-2-en-1-ol.
Molecular Properties
| Compound Name | 1,1-bis(1-methylimidazol-2-yl)-3,3-diphenylprop-2-en-1-ol |
| PubChem CID | 171986160 |
| Molecular Formula | C23H22N4O |
| Molecular Weight | 370.46 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | 1,1-bis(1-methylimidazol-2-yl)-3,3-diphenylprop-2-en-1-ol |
| SMILES | Cn1ccnc1C(O)(C=C(c1ccccc1)c1ccccc1)c1nccn1C |
| InChI | InChI=1S/C23H22N4O/c1-26-15-13-24-21(26)23(28,22-25-14-16-27(22)2)17-20(18-9-5-3-6-10-18)19-11-7-4-8-12-19/h3-17,28H,1-2H3 |
| InChIKey | RCAXDEBTFMHSFT-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 370.46 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1,1-bis(1-methylimidazol-2-yl)-3,3-diphenylprop-2-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-bis(1-methylimidazol-2-yl)-3,3-diphenylprop-2-en-1-ol?
The IUPAC name of 1,1-bis(1-methylimidazol-2-yl)-3,3-diphenylprop-2-en-1-ol (CID 171986160) is 1,1-bis(1-methylimidazol-2-yl)-3,3-diphenylprop-2-en-1-ol.
What is the SMILES notation for 1,1-bis(1-methylimidazol-2-yl)-3,3-diphenylprop-2-en-1-ol?
The canonical SMILES for 1,1-bis(1-methylimidazol-2-yl)-3,3-diphenylprop-2-en-1-ol is Cn1ccnc1C(O)(C=C(c1ccccc1)c1ccccc1)c1nccn1C.
What is the InChIKey of 1,1-bis(1-methylimidazol-2-yl)-3,3-diphenylprop-2-en-1-ol?
The InChIKey is RCAXDEBTFMHSFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H22N4O/c1-26-15-13-24-21(26)23(28,22-25-14-16-27(22)2)17-20(18-9-5-3-6-10-18)19-11-7-4-8-12-19/h3-17,28H,1-2H3.
What are the key properties of 1,1-bis(1-methylimidazol-2-yl)-3,3-diphenylprop-2-en-1-ol?
1,1-bis(1-methylimidazol-2-yl)-3,3-diphenylprop-2-en-1-ol has a molecular weight of 370.46 g/mol, XLogP of 3.52, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-bis(1-methylimidazol-2-yl)-3,3-diphenylprop-2-en-1-ol is sourced from PubChem (CID 171986160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).