C21H24N2O3 — CID 171986323
4-[1-(methoxymethyl)imidazol-2-yl]-1,1-diphenylbutane-1,3-diol (PubChem CID 171986323) has the molecular formula C21H24N2O3 and a molecular weight of 352.43 g/mol. Its IUPAC name is 4-[1-(methoxymethyl)imidazol-2-yl]-1,1-diphenylbutane-1,3-diol.
| Compound Name | 4-[1-(methoxymethyl)imidazol-2-yl]-1,1-diphenylbutane-1,3-diol |
|---|---|
| PubChem CID | 171986323 |
| Molecular Formula | C21H24N2O3 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | 4-[1-(methoxymethyl)imidazol-2-yl]-1,1-diphenylbutane-1,3-diol |
| SMILES | COCn1ccnc1CC(O)CC(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H24N2O3/c1-26-16-23-13-12-22-20(23)14-19(24)15-21(25,17-8-4-2-5-9-17)18-10-6-3-7-11-18/h2-13,19,24-25H,14-16H2,1H3 |
| InChIKey | BBPHWLBTWSJUOA-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |