C20H15N3O4S2 — CID 17198670
2-([1,2,4]triazolo[3,4-b][1,3]benzothiazol-1-ylsulfanyl)ethyl (E)-3-(1,3-benzodioxol-5-yl)prop-2-enoate (PubChem CID 17198670) has the molecular formula C20H15N3O4S2 and a molecular weight of 425.49 g/mol. Its IUPAC name is 2-([1,2,4]triazolo[3,4-b][1,3]benzothiazol-1-ylsulfanyl)ethyl (E)-3-(1,3-benzodioxol-5-yl)prop-2-enoate.
| Compound Name | 2-([1,2,4]triazolo[3,4-b][1,3]benzothiazol-1-ylsulfanyl)ethyl (E)-3-(1,3-benzodioxol-5-yl)prop-2-enoate |
|---|---|
| PubChem CID | 17198670 |
| Molecular Formula | C20H15N3O4S2 |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.05 |
| IUPAC Name | 2-([1,2,4]triazolo[3,4-b][1,3]benzothiazol-1-ylsulfanyl)ethyl (E)-3-(1,3-benzodioxol-5-yl)prop-2-enoate |
| SMILES | O=C(/C=C/c1ccc2c(c1)OCO2)OCCSc1nnc2sc3ccccc3n12 |
| InChI | InChI=1S/C20H15N3O4S2/c24-18(8-6-13-5-7-15-16(11-13)27-12-26-15)25-9-10-28-19-21-22-20-23(19)14-3-1-2-4-17(14)29-20/h1-8,11H,9-10,12H2/b8-6+ |
| InChIKey | XCQCAFYHHARVPD-SOFGYWHQSA-N |
| XLogP | 4.02 |
| TPSA | 74.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|