About 5-(1-methylimidazol-2-yl)-2,4-diphenyl-1H-imidazole
5-(1-methylimidazol-2-yl)-2,4-diphenyl-1H-imidazole (PubChem CID 171986846) has the molecular formula C19H16N4
and a molecular weight of 300.37 g/mol. Its IUPAC name is 5-(1-methylimidazol-2-yl)-2,4-diphenyl-1H-imidazole.
Molecular Properties
| Compound Name | 5-(1-methylimidazol-2-yl)-2,4-diphenyl-1H-imidazole |
| PubChem CID | 171986846 |
| Molecular Formula | C19H16N4 |
| Molecular Weight | 300.37 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | 5-(1-methylimidazol-2-yl)-2,4-diphenyl-1H-imidazole |
| SMILES | Cn1ccnc1-c1[nH]c(-c2ccccc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C19H16N4/c1-23-13-12-20-19(23)17-16(14-8-4-2-5-9-14)21-18(22-17)15-10-6-3-7-11-15/h2-13H,1H3,(H,21,22) |
| InChIKey | PVYHNYQDEGCPBC-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.37 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-(1-methylimidazol-2-yl)-2,4-diphenyl-1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1-methylimidazol-2-yl)-2,4-diphenyl-1H-imidazole?
The IUPAC name of 5-(1-methylimidazol-2-yl)-2,4-diphenyl-1H-imidazole (CID 171986846) is 5-(1-methylimidazol-2-yl)-2,4-diphenyl-1H-imidazole.
What is the SMILES notation for 5-(1-methylimidazol-2-yl)-2,4-diphenyl-1H-imidazole?
The canonical SMILES for 5-(1-methylimidazol-2-yl)-2,4-diphenyl-1H-imidazole is Cn1ccnc1-c1[nH]c(-c2ccccc2)nc1-c1ccccc1.
What is the InChIKey of 5-(1-methylimidazol-2-yl)-2,4-diphenyl-1H-imidazole?
The InChIKey is PVYHNYQDEGCPBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16N4/c1-23-13-12-20-19(23)17-16(14-8-4-2-5-9-14)21-18(22-17)15-10-6-3-7-11-15/h2-13H,1H3,(H,21,22).
What are the key properties of 5-(1-methylimidazol-2-yl)-2,4-diphenyl-1H-imidazole?
5-(1-methylimidazol-2-yl)-2,4-diphenyl-1H-imidazole has a molecular weight of 300.37 g/mol, XLogP of 4.14, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1-methylimidazol-2-yl)-2,4-diphenyl-1H-imidazole is sourced from PubChem (CID 171986846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).