About 6-phenacyl-1-phenyl-6-azaspiro[2.5]octane-2,2-dicarbonitrile
6-phenacyl-1-phenyl-6-azaspiro[2.5]octane-2,2-dicarbonitrile (PubChem CID 171987469) has the molecular formula C23H21N3O
and a molecular weight of 355.44 g/mol. Its IUPAC name is 6-phenacyl-1-phenyl-6-azaspiro[2.5]octane-2,2-dicarbonitrile.
Molecular Properties
| Compound Name | 6-phenacyl-1-phenyl-6-azaspiro[2.5]octane-2,2-dicarbonitrile |
| PubChem CID | 171987469 |
| Molecular Formula | C23H21N3O |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.17 |
| IUPAC Name | 6-phenacyl-1-phenyl-6-azaspiro[2.5]octane-2,2-dicarbonitrile |
| SMILES | N#CC1(C#N)C(c2ccccc2)C12CCN(CC(=O)c1ccccc1)CC2 |
| InChI | InChI=1S/C23H21N3O/c24-16-23(17-25)21(19-9-5-2-6-10-19)22(23)11-13-26(14-12-22)15-20(27)18-7-3-1-4-8-18/h1-10,21H,11-15H2 |
| InChIKey | OXNFVKDNAUMBRG-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 67.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-phenacyl-1-phenyl-6-azaspiro[2.5]octane-2,2-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-phenacyl-1-phenyl-6-azaspiro[2.5]octane-2,2-dicarbonitrile?
The IUPAC name of 6-phenacyl-1-phenyl-6-azaspiro[2.5]octane-2,2-dicarbonitrile (CID 171987469) is 6-phenacyl-1-phenyl-6-azaspiro[2.5]octane-2,2-dicarbonitrile.
What is the SMILES notation for 6-phenacyl-1-phenyl-6-azaspiro[2.5]octane-2,2-dicarbonitrile?
The canonical SMILES for 6-phenacyl-1-phenyl-6-azaspiro[2.5]octane-2,2-dicarbonitrile is N#CC1(C#N)C(c2ccccc2)C12CCN(CC(=O)c1ccccc1)CC2.
What is the InChIKey of 6-phenacyl-1-phenyl-6-azaspiro[2.5]octane-2,2-dicarbonitrile?
The InChIKey is OXNFVKDNAUMBRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H21N3O/c24-16-23(17-25)21(19-9-5-2-6-10-19)22(23)11-13-26(14-12-22)15-20(27)18-7-3-1-4-8-18/h1-10,21H,11-15H2.
What are the key properties of 6-phenacyl-1-phenyl-6-azaspiro[2.5]octane-2,2-dicarbonitrile?
6-phenacyl-1-phenyl-6-azaspiro[2.5]octane-2,2-dicarbonitrile has a molecular weight of 355.44 g/mol, XLogP of 3.78, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-phenacyl-1-phenyl-6-azaspiro[2.5]octane-2,2-dicarbonitrile is sourced from PubChem (CID 171987469), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).